About 2,2-diethoxymorpholine
2,2-diethoxymorpholine (PubChem CID 19959513) has the molecular formula C8H17NO3
and a molecular weight of 175.23 g/mol. Its IUPAC name is 2,2-diethoxymorpholine.
Molecular Properties
| Compound Name | 2,2-diethoxymorpholine |
| PubChem CID | 19959513 |
| Molecular Formula | C8H17NO3 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.12 |
| IUPAC Name | 2,2-diethoxymorpholine |
| SMILES | CCOC1(OCC)CNCCO1 |
| InChI | InChI=1S/C8H17NO3/c1-3-10-8(11-4-2)7-9-5-6-12-8/h9H,3-7H2,1-2H3 |
| InChIKey | VJUQNCZANIWGSX-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 2,2-diethoxymorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-diethoxymorpholine?
The IUPAC name of 2,2-diethoxymorpholine (CID 19959513) is 2,2-diethoxymorpholine.
What is the SMILES notation for 2,2-diethoxymorpholine?
The canonical SMILES for 2,2-diethoxymorpholine is CCOC1(OCC)CNCCO1.
What is the InChIKey of 2,2-diethoxymorpholine?
The InChIKey is VJUQNCZANIWGSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO3/c1-3-10-8(11-4-2)7-9-5-6-12-8/h9H,3-7H2,1-2H3.
What are the key properties of 2,2-diethoxymorpholine?
2,2-diethoxymorpholine has a molecular weight of 175.23 g/mol, XLogP of 0.33, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-diethoxymorpholine is sourced from PubChem (CID 19959513), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).