C8H17NO3 — CID 19959513
2,2-diethoxymorpholine (PubChem CID 19959513) has the molecular formula C8H17NO3 and a molecular weight of 175.23 g/mol. Its IUPAC name is 2,2-diethoxymorpholine.
| Compound Name | 2,2-diethoxymorpholine |
|---|---|
| PubChem CID | 19959513 |
| Molecular Formula | C8H17NO3 |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.12 |
| IUPAC Name | 2,2-diethoxymorpholine |
| SMILES | CCOC1(OCC)CNCCO1 |
| InChI | InChI=1S/C8H17NO3/c1-3-10-8(11-4-2)7-9-5-6-12-8/h9H,3-7H2,1-2H3 |
| InChIKey | VJUQNCZANIWGSX-UHFFFAOYSA-N |
| XLogP | 0.33 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 0.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|