C10H21NO3 — CID 70348686
acetic acid;2,2-diethylmorpholine (PubChem CID 70348686) has the molecular formula C10H21NO3 and a molecular weight of 203.28 g/mol. Its IUPAC name is acetic acid;2,2-diethylmorpholine.
| Compound Name | acetic acid;2,2-diethylmorpholine |
|---|---|
| PubChem CID | 70348686 |
| Molecular Formula | C10H21NO3 |
| Molecular Weight | 203.28 g/mol |
| Exact Mass | 203.15 |
| IUPAC Name | acetic acid;2,2-diethylmorpholine |
| SMILES | CC(=O)O.CCC1(CC)CNCCO1 |
| InChI | InChI=1S/C8H17NO.C2H4O2/c1-3-8(4-2)7-9-5-6-10-8;1-2(3)4/h9H,3-7H2,1-2H3;1H3,(H,3,4) |
| InChIKey | FZKLPVZMWMTYJT-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.28 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |