About 1,1-diethoxycyclopropane;sulfane
1,1-diethoxycyclopropane;sulfane (PubChem CID 175457696) has the molecular formula C7H16O2S
and a molecular weight of 164.27 g/mol. Its IUPAC name is 1,1-diethoxycyclopropane;sulfane.
Molecular Properties
| Compound Name | 1,1-diethoxycyclopropane;sulfane |
| PubChem CID | 175457696 |
| Molecular Formula | C7H16O2S |
| Molecular Weight | 164.27 g/mol |
| Exact Mass | 164.09 |
| IUPAC Name | 1,1-diethoxycyclopropane;sulfane |
| SMILES | CCOC1(OCC)CC1.S |
| InChI | InChI=1S/C7H14O2.H2S/c1-3-8-7(5-6-7)9-4-2;/h3-6H2,1-2H3;1H2 |
| InChIKey | YGOIBGQNMMLHET-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.27 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1,1-diethoxycyclopropane;sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-diethoxycyclopropane;sulfane?
The IUPAC name of 1,1-diethoxycyclopropane;sulfane (CID 175457696) is 1,1-diethoxycyclopropane;sulfane.
What is the SMILES notation for 1,1-diethoxycyclopropane;sulfane?
The canonical SMILES for 1,1-diethoxycyclopropane;sulfane is CCOC1(OCC)CC1.S.
What is the InChIKey of 1,1-diethoxycyclopropane;sulfane?
The InChIKey is YGOIBGQNMMLHET-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14O2.H2S/c1-3-8-7(5-6-7)9-4-2;/h3-6H2,1-2H3;1H2.
What are the key properties of 1,1-diethoxycyclopropane;sulfane?
1,1-diethoxycyclopropane;sulfane has a molecular weight of 164.27 g/mol, XLogP of 1.66, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-diethoxycyclopropane;sulfane is sourced from PubChem (CID 175457696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).