C17H28O5SSi — CID 178181403
1-(benzenesulfonyl)cyclopropan-1-ol;(1-ethoxycyclopropyl)oxy-trimethylsilane (PubChem CID 178181403) has the molecular formula C17H28O5SSi and a molecular weight of 372.56 g/mol. Its IUPAC name is 1-(benzenesulfonyl)cyclopropan-1-ol;(1-ethoxycyclopropyl)oxy-trimethylsilane.
| Compound Name | 1-(benzenesulfonyl)cyclopropan-1-ol;(1-ethoxycyclopropyl)oxy-trimethylsilane |
|---|---|
| PubChem CID | 178181403 |
| Molecular Formula | C17H28O5SSi |
| Molecular Weight | 372.56 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 1-(benzenesulfonyl)cyclopropan-1-ol;(1-ethoxycyclopropyl)oxy-trimethylsilane |
| SMILES | CCOC1(O[Si](C)(C)C)CC1.O=S(=O)(c1ccccc1)C1(O)CC1 |
| InChI | InChI=1S/C9H10O3S.C8H18O2Si/c10-9(6-7-9)13(11,12)8-4-2-1-3-5-8;1-5-9-8(6-7-8)10-11(2,3)4/h1-5,10H,6-7H2;5-7H2,1-4H3 |
| InChIKey | MTEULRADVWZULA-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.56 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|