C21H26NO4S+ — CID 7081642
ethyl 4-(benzenesulfonyl)-1-benzylpiperidin-1-ium-4-carboxylate (PubChem CID 7081642) has the molecular formula C21H26NO4S+ and a molecular weight of 388.51 g/mol. Its IUPAC name is ethyl 4-(benzenesulfonyl)-1-benzylpiperidin-1-ium-4-carboxylate.
| Compound Name | ethyl 4-(benzenesulfonyl)-1-benzylpiperidin-1-ium-4-carboxylate |
|---|---|
| PubChem CID | 7081642 |
| Molecular Formula | C21H26NO4S+ |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.16 |
| IUPAC Name | ethyl 4-(benzenesulfonyl)-1-benzylpiperidin-1-ium-4-carboxylate |
| SMILES | CCOC(=O)C1(S(=O)(=O)c2ccccc2)CC[NH+](Cc2ccccc2)CC1 |
| InChI | InChI=1S/C21H25NO4S/c1-2-26-20(23)21(27(24,25)19-11-7-4-8-12-19)13-15-22(16-14-21)17-18-9-5-3-6-10-18/h3-12H,2,13-17H2,1H3/p+1 |
| InChIKey | BWFLVWOFJXJIIY-UHFFFAOYSA-O |
| XLogP | 1.64 |
| TPSA | 64.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |