C15H24O3SSi — CID 23254499
2-[(1R,2R)-2-(benzenesulfonyl)-2-(trimethylsilylmethyl)cyclopropyl]ethanol (PubChem CID 23254499) has the molecular formula C15H24O3SSi and a molecular weight of 312.51 g/mol. Its IUPAC name is 2-[(1R,2R)-2-(benzenesulfonyl)-2-(trimethylsilylmethyl)cyclopropyl]ethanol.
| Compound Name | 2-[(1R,2R)-2-(benzenesulfonyl)-2-(trimethylsilylmethyl)cyclopropyl]ethanol |
|---|---|
| PubChem CID | 23254499 |
| Molecular Formula | C15H24O3SSi |
| Molecular Weight | 312.51 g/mol |
| Exact Mass | 312.12 |
| IUPAC Name | 2-[(1R,2R)-2-(benzenesulfonyl)-2-(trimethylsilylmethyl)cyclopropyl]ethanol |
| SMILES | C[Si](C)(C)C[C@@]1(S(=O)(=O)c2ccccc2)C[C@H]1CCO |
| InChI | InChI=1S/C15H24O3SSi/c1-20(2,3)12-15(11-13(15)9-10-16)19(17,18)14-7-5-4-6-8-14/h4-8,13,16H,9-12H2,1-3H3/t13-,15+/m1/s1 |
| InChIKey | ZSVKBLJFJXMLOE-HIFRSBDPSA-N |
| XLogP | 2.94 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.51 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|