C21H22O4S2 — CID 102328450
[(2R)-1-(benzenesulfonyl)-2-(3,3-dimethylbut-1-ynyl)cyclopropyl]sulfonylbenzene (PubChem CID 102328450) has the molecular formula C21H22O4S2 and a molecular weight of 402.54 g/mol. Its IUPAC name is [(2R)-1-(benzenesulfonyl)-2-(3,3-dimethylbut-1-ynyl)cyclopropyl]sulfonylbenzene.
| Compound Name | [(2R)-1-(benzenesulfonyl)-2-(3,3-dimethylbut-1-ynyl)cyclopropyl]sulfonylbenzene |
|---|---|
| PubChem CID | 102328450 |
| Molecular Formula | C21H22O4S2 |
| Molecular Weight | 402.54 g/mol |
| Exact Mass | 402.10 |
| IUPAC Name | [(2R)-1-(benzenesulfonyl)-2-(3,3-dimethylbut-1-ynyl)cyclopropyl]sulfonylbenzene |
| SMILES | CC(C)(C)C#C[C@H]1CC1(S(=O)(=O)c1ccccc1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C21H22O4S2/c1-20(2,3)15-14-17-16-21(17,26(22,23)18-10-6-4-7-11-18)27(24,25)19-12-8-5-9-13-19/h4-13,17H,16H2,1-3H3/t17-/m0/s1 |
| InChIKey | UFMMXZLZYKBTJE-KRWDZBQOSA-N |
| XLogP | 3.70 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.54 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|