C28H26O2SSi — CID 11004939
[(1S,2S)-2-(benzenesulfonyl)-2-methylcyclopropyl]-triphenylsilane (PubChem CID 11004939) has the molecular formula C28H26O2SSi and a molecular weight of 454.67 g/mol. Its IUPAC name is [(1S,2S)-2-(benzenesulfonyl)-2-methylcyclopropyl]-triphenylsilane.
| Compound Name | [(1S,2S)-2-(benzenesulfonyl)-2-methylcyclopropyl]-triphenylsilane |
|---|---|
| PubChem CID | 11004939 |
| Molecular Formula | C28H26O2SSi |
| Molecular Weight | 454.67 g/mol |
| Exact Mass | 454.14 |
| IUPAC Name | [(1S,2S)-2-(benzenesulfonyl)-2-methylcyclopropyl]-triphenylsilane |
| SMILES | C[C@]1(S(=O)(=O)c2ccccc2)C[C@@H]1[Si](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H26O2SSi/c1-28(31(29,30)23-14-6-2-7-15-23)22-27(28)32(24-16-8-3-9-17-24,25-18-10-4-11-19-25)26-20-12-5-13-21-26/h2-21,27H,22H2,1H3/t27-,28-/m0/s1 |
| InChIKey | ZVVULFYUENYKGM-NSOVKSMOSA-N |
| XLogP | 4.16 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.67 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|