C20H20O4S2 — CID 11090383
(1S,2S,5R,6R)-1,2-bis(benzenesulfonyl)tricyclo[4.2.0.02,5]octane (PubChem CID 11090383) has the molecular formula C20H20O4S2 and a molecular weight of 388.51 g/mol. Its IUPAC name is (1S,2S,5R,6R)-1,2-bis(benzenesulfonyl)tricyclo[4.2.0.02,5]octane.
| Compound Name | (1S,2S,5R,6R)-1,2-bis(benzenesulfonyl)tricyclo[4.2.0.02,5]octane |
|---|---|
| PubChem CID | 11090383 |
| Molecular Formula | C20H20O4S2 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | (1S,2S,5R,6R)-1,2-bis(benzenesulfonyl)tricyclo[4.2.0.02,5]octane |
| SMILES | O=S(=O)(c1ccccc1)[C@@]12CC[C@@H]1[C@H]1CC[C@]12S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H20O4S2/c21-25(22,15-7-3-1-4-8-15)19-13-11-17(19)18-12-14-20(18,19)26(23,24)16-9-5-2-6-10-16/h1-10,17-18H,11-14H2/t17-,18-,19+,20+/m1/s1 |
| InChIKey | CTMHXDMPCJRNGA-ZRNYENFQSA-N |
| XLogP | 3.25 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |