C19H18O2S — CID 23726952
(2S,6R)-1-(benzenesulfonyl)-7-phenyltricyclo[4.1.0.02,7]heptane (PubChem CID 23726952) has the molecular formula C19H18O2S and a molecular weight of 310.42 g/mol. Its IUPAC name is (2S,6R)-1-(benzenesulfonyl)-7-phenyltricyclo[4.1.0.02,7]heptane.
| Compound Name | (2S,6R)-1-(benzenesulfonyl)-7-phenyltricyclo[4.1.0.02,7]heptane |
|---|---|
| PubChem CID | 23726952 |
| Molecular Formula | C19H18O2S |
| Molecular Weight | 310.42 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | (2S,6R)-1-(benzenesulfonyl)-7-phenyltricyclo[4.1.0.02,7]heptane |
| SMILES | O=S(=O)(c1ccccc1)C12[C@@H]3CCC[C@H]1C32c1ccccc1 |
| InChI | InChI=1S/C19H18O2S/c20-22(21,15-10-5-2-6-11-15)19-16-12-7-13-17(19)18(16,19)14-8-3-1-4-9-14/h1-6,8-11,16-17H,7,12-13H2/t16-,17+,18?,19? |
| InChIKey | BUHZRACPBSEWGQ-LPOKXYRGSA-N |
| XLogP | 3.58 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.42 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |