C31H24N2O4S2 — CID 134865952
N-[5-(benzenesulfonamido)-7,7-diphenyl-2-bicyclo[4.1.0]hepta-1,3,5-trienyl]benzenesulfonamide (PubChem CID 134865952) has the molecular formula C31H24N2O4S2 and a molecular weight of 552.68 g/mol. Its IUPAC name is N-[5-(benzenesulfonamido)-7,7-diphenyl-2-bicyclo[4.1.0]hepta-1,3,5-trienyl]benzenesulfonamide.
| Compound Name | N-[5-(benzenesulfonamido)-7,7-diphenyl-2-bicyclo[4.1.0]hepta-1,3,5-trienyl]benzenesulfonamide |
|---|---|
| PubChem CID | 134865952 |
| Molecular Formula | C31H24N2O4S2 |
| Molecular Weight | 552.68 g/mol |
| Exact Mass | 552.12 |
| IUPAC Name | N-[5-(benzenesulfonamido)-7,7-diphenyl-2-bicyclo[4.1.0]hepta-1,3,5-trienyl]benzenesulfonamide |
| SMILES | O=S(=O)(Nc1ccc(NS(=O)(=O)c2ccccc2)c2c1C2(c1ccccc1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H24N2O4S2/c34-38(35,25-17-9-3-10-18-25)32-27-21-22-28(33-39(36,37)26-19-11-4-12-20-26)30-29(27)31(30,23-13-5-1-6-14-23)24-15-7-2-8-16-24/h1-22,32-33H |
| InChIKey | FRXFKTSKSAXQFF-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.68 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'sulfonamide_D(2)', 'substructure': 'N/A'} |
|---|