C18H14N4O8S2 — CID 142740286
N-[2-(benzenesulfonamido)-4,5-dinitrophenyl]benzenesulfonamide (PubChem CID 142740286) has the molecular formula C18H14N4O8S2 and a molecular weight of 478.46 g/mol. Its IUPAC name is N-[2-(benzenesulfonamido)-4,5-dinitrophenyl]benzenesulfonamide.
| Compound Name | N-[2-(benzenesulfonamido)-4,5-dinitrophenyl]benzenesulfonamide |
|---|---|
| PubChem CID | 142740286 |
| Molecular Formula | C18H14N4O8S2 |
| Molecular Weight | 478.46 g/mol |
| Exact Mass | 478.03 |
| IUPAC Name | N-[2-(benzenesulfonamido)-4,5-dinitrophenyl]benzenesulfonamide |
| SMILES | O=[N+]([O-])c1cc(NS(=O)(=O)c2ccccc2)c(NS(=O)(=O)c2ccccc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H14N4O8S2/c23-21(24)17-11-15(19-31(27,28)13-7-3-1-4-8-13)16(12-18(17)22(25)26)20-32(29,30)14-9-5-2-6-10-14/h1-12,19-20H |
| InChIKey | BFAMCXXOZPSNQP-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 178.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.46 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|