C22H20O4S2 — CID 134117089
9,9-bis(benzenesulfonyl)tricyclo[4.2.2.02,5]deca-3,7-diene (PubChem CID 134117089) has the molecular formula C22H20O4S2 and a molecular weight of 412.53 g/mol. Its IUPAC name is 9,9-bis(benzenesulfonyl)tricyclo[4.2.2.02,5]deca-3,7-diene.
| Compound Name | 9,9-bis(benzenesulfonyl)tricyclo[4.2.2.02,5]deca-3,7-diene |
|---|---|
| PubChem CID | 134117089 |
| Molecular Formula | C22H20O4S2 |
| Molecular Weight | 412.53 g/mol |
| Exact Mass | 412.08 |
| IUPAC Name | 9,9-bis(benzenesulfonyl)tricyclo[4.2.2.02,5]deca-3,7-diene |
| SMILES | O=S(=O)(c1ccccc1)C1(S(=O)(=O)c2ccccc2)CC2C=CC1C1C=CC21 |
| InChI | InChI=1S/C22H20O4S2/c23-27(24,17-7-3-1-4-8-17)22(28(25,26)18-9-5-2-6-10-18)15-16-11-14-21(22)20-13-12-19(16)20/h1-14,16,19-21H,15H2 |
| InChIKey | FVEHSFSSYYUJRJ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.53 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|