C13H13FO2S — CID 134986321
(1S,4S,6R)-1-(benzenesulfonyl)-6-fluorobicyclo[2.2.1]hept-2-ene (PubChem CID 134986321) has the molecular formula C13H13FO2S and a molecular weight of 252.31 g/mol. Its IUPAC name is (1S,4S,6R)-1-(benzenesulfonyl)-6-fluorobicyclo[2.2.1]hept-2-ene.
| Compound Name | (1S,4S,6R)-1-(benzenesulfonyl)-6-fluorobicyclo[2.2.1]hept-2-ene |
|---|---|
| PubChem CID | 134986321 |
| Molecular Formula | C13H13FO2S |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.06 |
| IUPAC Name | (1S,4S,6R)-1-(benzenesulfonyl)-6-fluorobicyclo[2.2.1]hept-2-ene |
| SMILES | O=S(=O)(c1ccccc1)[C@@]12C=C[C@@H](C[C@H]1F)C2 |
| InChI | InChI=1S/C13H13FO2S/c14-12-8-10-6-7-13(12,9-10)17(15,16)11-4-2-1-3-5-11/h1-7,10,12H,8-9H2/t10-,12+,13+/m0/s1 |
| InChIKey | MDGXBCMKGZSKRK-CYZMBNFOSA-N |
| XLogP | 2.52 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|