About (NE)-N-[6,6-bis(benzenesulfonyl)-2-bicyclo[2.2.1]heptanylidene]hydroxylamine
(NE)-N-[6,6-bis(benzenesulfonyl)-2-bicyclo[2.2.1]heptanylidene]hydroxylamine (PubChem CID 135067019) has the molecular formula C19H19NO5S2
and a molecular weight of 405.50 g/mol. Its IUPAC name is (NE)-N-[6,6-bis(benzenesulfonyl)-2-bicyclo[2.2.1]heptanylidene]hydroxylamine.
Molecular Properties
| Compound Name | (NE)-N-[6,6-bis(benzenesulfonyl)-2-bicyclo[2.2.1]heptanylidene]hydroxylamine |
| PubChem CID | 135067019 |
| Molecular Formula | C19H19NO5S2 |
| Molecular Weight | 405.50 g/mol |
| Exact Mass | 405.07 |
| IUPAC Name | (NE)-N-[6,6-bis(benzenesulfonyl)-2-bicyclo[2.2.1]heptanylidene]hydroxylamine |
| SMILES | O=S(=O)(c1ccccc1)C1(S(=O)(=O)c2ccccc2)CC2C/C(=N\O)C1C2 |
| InChI | InChI=1S/C19H19NO5S2/c21-20-18-12-14-11-17(18)19(13-14,26(22,23)15-7-3-1-4-8-15)27(24,25)16-9-5-2-6-10-16/h1-10,14,17,21H,11-13H2/b20-18+ |
| InChIKey | MNISJTZAOIZSGE-CZIZESTLSA-N |
| XLogP | 2.89 |
| TPSA | 100.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 405.50 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (NE)-N-[6,6-bis(benzenesulfonyl)-2-bicyclo[2.2.1]heptanylidene]hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (NE)-N-[6,6-bis(benzenesulfonyl)-2-bicyclo[2.2.1]heptanylidene]hydroxylamine?
The IUPAC name of (NE)-N-[6,6-bis(benzenesulfonyl)-2-bicyclo[2.2.1]heptanylidene]hydroxylamine (CID 135067019) is (NE)-N-[6,6-bis(benzenesulfonyl)-2-bicyclo[2.2.1]heptanylidene]hydroxylamine.
What is the SMILES notation for (NE)-N-[6,6-bis(benzenesulfonyl)-2-bicyclo[2.2.1]heptanylidene]hydroxylamine?
The canonical SMILES for (NE)-N-[6,6-bis(benzenesulfonyl)-2-bicyclo[2.2.1]heptanylidene]hydroxylamine is O=S(=O)(c1ccccc1)C1(S(=O)(=O)c2ccccc2)CC2C/C(=N\O)C1C2.
What is the InChIKey of (NE)-N-[6,6-bis(benzenesulfonyl)-2-bicyclo[2.2.1]heptanylidene]hydroxylamine?
The InChIKey is MNISJTZAOIZSGE-CZIZESTLSA-N. The full InChI is InChI=1S/C19H19NO5S2/c21-20-18-12-14-11-17(18)19(13-14,26(22,23)15-7-3-1-4-8-15)27(24,25)16-9-5-2-6-10-16/h1-10,14,17,21H,11-13H2/b20-18+.
What are the key properties of (NE)-N-[6,6-bis(benzenesulfonyl)-2-bicyclo[2.2.1]heptanylidene]hydroxylamine?
(NE)-N-[6,6-bis(benzenesulfonyl)-2-bicyclo[2.2.1]heptanylidene]hydroxylamine has a molecular weight of 405.50 g/mol, XLogP of 2.89, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (NE)-N-[6,6-bis(benzenesulfonyl)-2-bicyclo[2.2.1]heptanylidene]hydroxylamine is sourced from PubChem (CID 135067019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).