C11H10O4S — CID 14320196
3-(benzenesulfonyl)bicyclo[1.1.0]butane-1-carboxylic acid (PubChem CID 14320196) has the molecular formula C11H10O4S and a molecular weight of 238.26 g/mol. Its IUPAC name is 3-(benzenesulfonyl)bicyclo[1.1.0]butane-1-carboxylic acid.
| Compound Name | 3-(benzenesulfonyl)bicyclo[1.1.0]butane-1-carboxylic acid |
|---|---|
| PubChem CID | 14320196 |
| Molecular Formula | C11H10O4S |
| Molecular Weight | 238.26 g/mol |
| Exact Mass | 238.03 |
| IUPAC Name | 3-(benzenesulfonyl)bicyclo[1.1.0]butane-1-carboxylic acid |
| SMILES | O=C(O)C12CC1(S(=O)(=O)c1ccccc1)C2 |
| InChI | InChI=1S/C11H10O4S/c12-9(13)10-6-11(10,7-10)16(14,15)8-4-2-1-3-5-8/h1-5H,6-7H2,(H,12,13) |
| InChIKey | HPDYJHFTSDBNEU-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.26 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |