C21H36O2SSi — CID 10339768
[1-(benzenesulfonyl)-2-octylcyclopropyl]methyl-trimethylsilane (PubChem CID 10339768) has the molecular formula C21H36O2SSi and a molecular weight of 380.67 g/mol. Its IUPAC name is [1-(benzenesulfonyl)-2-octylcyclopropyl]methyl-trimethylsilane.
| Compound Name | [1-(benzenesulfonyl)-2-octylcyclopropyl]methyl-trimethylsilane |
|---|---|
| PubChem CID | 10339768 |
| Molecular Formula | C21H36O2SSi |
| Molecular Weight | 380.67 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | [1-(benzenesulfonyl)-2-octylcyclopropyl]methyl-trimethylsilane |
| SMILES | CCCCCCCCC1CC1(C[Si](C)(C)C)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C21H36O2SSi/c1-5-6-7-8-9-11-14-19-17-21(19,18-25(2,3)4)24(22,23)20-15-12-10-13-16-20/h10,12-13,15-16,19H,5-9,11,14,17-18H2,1-4H3 |
| InChIKey | COIGITICYFXWRF-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.67 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|