C18H26O3S — CID 102122716
1-[(1S,2S)-1-(benzenesulfonyl)-2-methylcyclopropyl]octan-1-one (PubChem CID 102122716) has the molecular formula C18H26O3S and a molecular weight of 322.47 g/mol. Its IUPAC name is 1-[(1S,2S)-1-(benzenesulfonyl)-2-methylcyclopropyl]octan-1-one.
| Compound Name | 1-[(1S,2S)-1-(benzenesulfonyl)-2-methylcyclopropyl]octan-1-one |
|---|---|
| PubChem CID | 102122716 |
| Molecular Formula | C18H26O3S |
| Molecular Weight | 322.47 g/mol |
| Exact Mass | 322.16 |
| IUPAC Name | 1-[(1S,2S)-1-(benzenesulfonyl)-2-methylcyclopropyl]octan-1-one |
| SMILES | CCCCCCCC(=O)[C@]1(S(=O)(=O)c2ccccc2)C[C@@H]1C |
| InChI | InChI=1S/C18H26O3S/c1-3-4-5-6-10-13-17(19)18(14-15(18)2)22(20,21)16-11-8-7-9-12-16/h7-9,11-12,15H,3-6,10,13-14H2,1-2H3/t15-,18-/m0/s1 |
| InChIKey | NPYXGWQAHLVNTK-YJBOKZPZSA-N |
| XLogP | 4.17 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.47 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|