About (5,5-diethoxy-1,3-dithian-2-ylidene)methanone
(5,5-diethoxy-1,3-dithian-2-ylidene)methanone (PubChem CID 174550653) has the molecular formula C9H14O3S2
and a molecular weight of 234.34 g/mol. Its IUPAC name is (5,5-diethoxy-1,3-dithian-2-ylidene)methanone.
Molecular Properties
| Compound Name | (5,5-diethoxy-1,3-dithian-2-ylidene)methanone |
| PubChem CID | 174550653 |
| Molecular Formula | C9H14O3S2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.04 |
| IUPAC Name | (5,5-diethoxy-1,3-dithian-2-ylidene)methanone |
| SMILES | CCOC1(OCC)CSC(=C=O)SC1 |
| InChI | InChI=1S/C9H14O3S2/c1-3-11-9(12-4-2)6-13-8(5-10)14-7-9/h3-4,6-7H2,1-2H3 |
| InChIKey | TVXASKOVCITNJH-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|
Analyze (5,5-diethoxy-1,3-dithian-2-ylidene)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5,5-diethoxy-1,3-dithian-2-ylidene)methanone?
The IUPAC name of (5,5-diethoxy-1,3-dithian-2-ylidene)methanone (CID 174550653) is (5,5-diethoxy-1,3-dithian-2-ylidene)methanone.
What is the SMILES notation for (5,5-diethoxy-1,3-dithian-2-ylidene)methanone?
The canonical SMILES for (5,5-diethoxy-1,3-dithian-2-ylidene)methanone is CCOC1(OCC)CSC(=C=O)SC1.
What is the InChIKey of (5,5-diethoxy-1,3-dithian-2-ylidene)methanone?
The InChIKey is TVXASKOVCITNJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14O3S2/c1-3-11-9(12-4-2)6-13-8(5-10)14-7-9/h3-4,6-7H2,1-2H3.
What are the key properties of (5,5-diethoxy-1,3-dithian-2-ylidene)methanone?
(5,5-diethoxy-1,3-dithian-2-ylidene)methanone has a molecular weight of 234.34 g/mol, XLogP of 1.91, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (5,5-diethoxy-1,3-dithian-2-ylidene)methanone is sourced from PubChem (CID 174550653), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).