C14H28O4 — CID 151917056
1,1,3,3-tetraethoxycyclohexane (PubChem CID 151917056) has the molecular formula C14H28O4 and a molecular weight of 260.37 g/mol. Its IUPAC name is 1,1,3,3-tetraethoxycyclohexane.
| Compound Name | 1,1,3,3-tetraethoxycyclohexane |
|---|---|
| PubChem CID | 151917056 |
| Molecular Formula | C14H28O4 |
| Molecular Weight | 260.37 g/mol |
| Exact Mass | 260.20 |
| IUPAC Name | 1,1,3,3-tetraethoxycyclohexane |
| SMILES | CCOC1(OCC)CCCC(OCC)(OCC)C1 |
| InChI | InChI=1S/C14H28O4/c1-5-15-13(16-6-2)10-9-11-14(12-13,17-7-3)18-8-4/h5-12H2,1-4H3 |
| InChIKey | SVZBUMILJRKIFJ-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.37 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|