About 1,1-dibutoxycyclopentane
1,1-dibutoxycyclopentane (PubChem CID 18792031) has the molecular formula C13H26O2
and a molecular weight of 214.35 g/mol. Its IUPAC name is 1,1-dibutoxycyclopentane.
Molecular Properties
| Compound Name | 1,1-dibutoxycyclopentane |
| PubChem CID | 18792031 |
| Molecular Formula | C13H26O2 |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.19 |
| IUPAC Name | 1,1-dibutoxycyclopentane |
| SMILES | CCCCOC1(OCCCC)CCCC1 |
| InChI | InChI=1S/C13H26O2/c1-3-5-11-14-13(9-7-8-10-13)15-12-6-4-2/h3-12H2,1-2H3 |
| InChIKey | ZIPJNBDDQVHKBL-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1,1-dibutoxycyclopentane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,1-dibutoxycyclopentane?
The IUPAC name of 1,1-dibutoxycyclopentane (CID 18792031) is 1,1-dibutoxycyclopentane.
What is the SMILES notation for 1,1-dibutoxycyclopentane?
The canonical SMILES for 1,1-dibutoxycyclopentane is CCCCOC1(OCCCC)CCCC1.
What is the InChIKey of 1,1-dibutoxycyclopentane?
The InChIKey is ZIPJNBDDQVHKBL-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26O2/c1-3-5-11-14-13(9-7-8-10-13)15-12-6-4-2/h3-12H2,1-2H3.
What are the key properties of 1,1-dibutoxycyclopentane?
1,1-dibutoxycyclopentane has a molecular weight of 214.35 g/mol, XLogP of 3.89, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,1-dibutoxycyclopentane is sourced from PubChem (CID 18792031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).