C17H34O2 — CID 155455157
1,1-bis(3,3-dimethylbutoxy)cyclopentane (PubChem CID 155455157) has the molecular formula C17H34O2 and a molecular weight of 270.46 g/mol. Its IUPAC name is 1,1-bis(3,3-dimethylbutoxy)cyclopentane.
| Compound Name | 1,1-bis(3,3-dimethylbutoxy)cyclopentane |
|---|---|
| PubChem CID | 155455157 |
| Molecular Formula | C17H34O2 |
| Molecular Weight | 270.46 g/mol |
| Exact Mass | 270.26 |
| IUPAC Name | 1,1-bis(3,3-dimethylbutoxy)cyclopentane |
| SMILES | CC(C)(C)CCOC1(OCCC(C)(C)C)CCCC1 |
| InChI | InChI=1S/C17H34O2/c1-15(2,3)11-13-18-17(9-7-8-10-17)19-14-12-16(4,5)6/h7-14H2,1-6H3 |
| InChIKey | XLOIBLBRSFEZFZ-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.46 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|