About 6,6-diethoxy-2,2-dimethyloxasilinane
6,6-diethoxy-2,2-dimethyloxasilinane (PubChem CID 22114371) has the molecular formula C10H22O3Si
and a molecular weight of 218.37 g/mol. Its IUPAC name is 6,6-diethoxy-2,2-dimethyloxasilinane.
Molecular Properties
| Compound Name | 6,6-diethoxy-2,2-dimethyloxasilinane |
| PubChem CID | 22114371 |
| Molecular Formula | C10H22O3Si |
| Molecular Weight | 218.37 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | 6,6-diethoxy-2,2-dimethyloxasilinane |
| SMILES | CCOC1(OCC)CCC[Si](C)(C)O1 |
| InChI | InChI=1S/C10H22O3Si/c1-5-11-10(12-6-2)8-7-9-14(3,4)13-10/h5-9H2,1-4H3 |
| InChIKey | UMVYEYFYUSEJHM-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.37 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 6,6-diethoxy-2,2-dimethyloxasilinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,6-diethoxy-2,2-dimethyloxasilinane?
The IUPAC name of 6,6-diethoxy-2,2-dimethyloxasilinane (CID 22114371) is 6,6-diethoxy-2,2-dimethyloxasilinane.
What is the SMILES notation for 6,6-diethoxy-2,2-dimethyloxasilinane?
The canonical SMILES for 6,6-diethoxy-2,2-dimethyloxasilinane is CCOC1(OCC)CCC[Si](C)(C)O1.
What is the InChIKey of 6,6-diethoxy-2,2-dimethyloxasilinane?
The InChIKey is UMVYEYFYUSEJHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22O3Si/c1-5-11-10(12-6-2)8-7-9-14(3,4)13-10/h5-9H2,1-4H3.
What are the key properties of 6,6-diethoxy-2,2-dimethyloxasilinane?
6,6-diethoxy-2,2-dimethyloxasilinane has a molecular weight of 218.37 g/mol, XLogP of 2.73, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6-diethoxy-2,2-dimethyloxasilinane is sourced from PubChem (CID 22114371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).