C28H64O8Si4 — CID 68657161
2,4,6,8-tetra(propan-2-yl)-2,4,6,8-tetrakis(propoxymethyl)-1,3,5,7,2,4,6,8-tetraoxatetrasilocane (PubChem CID 68657161) has the molecular formula C28H64O8Si4 and a molecular weight of 641.16 g/mol. Its IUPAC name is 2,4,6,8-tetra(propan-2-yl)-2,4,6,8-tetrakis(propoxymethyl)-1,3,5,7,2,4,6,8-tetraoxatetrasilocane.
| Compound Name | 2,4,6,8-tetra(propan-2-yl)-2,4,6,8-tetrakis(propoxymethyl)-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
|---|---|
| PubChem CID | 68657161 |
| Molecular Formula | C28H64O8Si4 |
| Molecular Weight | 641.16 g/mol |
| Exact Mass | 640.37 |
| IUPAC Name | 2,4,6,8-tetra(propan-2-yl)-2,4,6,8-tetrakis(propoxymethyl)-1,3,5,7,2,4,6,8-tetraoxatetrasilocane |
| SMILES | CCCOC[Si]1(C(C)C)O[Si](COCCC)(C(C)C)O[Si](COCCC)(C(C)C)O[Si](COCCC)(C(C)C)O1 |
| InChI | InChI=1S/C28H64O8Si4/c1-13-17-29-21-37(25(5)6)33-38(26(7)8,22-30-18-14-2)35-40(28(11)12,24-32-20-16-4)36-39(34-37,27(9)10)23-31-19-15-3/h25-28H,13-24H2,1-12H3 |
| InChIKey | LZGQVUPPONOZHL-UHFFFAOYSA-N |
| XLogP | 7.34 |
| TPSA | 73.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 641.16 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|