About CID 22242256
CID 22242256 (PubChem CID 22242256) has the molecular formula C10H23O2Si
and a molecular weight of 203.38 g/mol.
Molecular Properties
| Compound Name | CID 22242256 |
| PubChem CID | 22242256 |
| Molecular Formula | C10H23O2Si |
| Molecular Weight | 203.38 g/mol |
| Exact Mass | 203.15 |
| IUPAC Name | — |
| SMILES | CCCO[Si](OCCC)C(C)CC |
| InChI | InChI=1S/C10H23O2Si/c1-5-8-11-13(10(4)7-3)12-9-6-2/h10H,5-9H2,1-4H3 |
| InChIKey | BSBGKXGSMHWTHM-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.38 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 22242256 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 22242256?
The IUPAC name of CID 22242256 (CID 22242256) is not available.
What is the SMILES notation for CID 22242256?
The canonical SMILES for CID 22242256 is CCCO[Si](OCCC)C(C)CC.
What is the InChIKey of CID 22242256?
The InChIKey is BSBGKXGSMHWTHM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H23O2Si/c1-5-8-11-13(10(4)7-3)12-9-6-2/h10H,5-9H2,1-4H3.
What are the key properties of CID 22242256?
CID 22242256 has a molecular weight of 203.38 g/mol, XLogP of 3.13, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 22242256 is sourced from PubChem (CID 22242256), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).