About CID 22924724
CID 22924724 (PubChem CID 22924724) has the molecular formula C7H15Cl2OSi
and a molecular weight of 214.19 g/mol.
Molecular Properties
| Compound Name | CID 22924724 |
| PubChem CID | 22924724 |
| Molecular Formula | C7H15Cl2OSi |
| Molecular Weight | 214.19 g/mol |
| Exact Mass | 213.03 |
| IUPAC Name | — |
| SMILES | CCCO[Si](Cl)C(Cl)CCC |
| InChI | InChI=1S/C7H15Cl2OSi/c1-3-5-7(8)11(9)10-6-4-2/h7H,3-6H2,1-2H3 |
| InChIKey | YSNSGHQLHSEFHQ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.19 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze CID 22924724 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 22924724?
The IUPAC name of CID 22924724 (CID 22924724) is not available.
What is the SMILES notation for CID 22924724?
The canonical SMILES for CID 22924724 is CCCO[Si](Cl)C(Cl)CCC.
What is the InChIKey of CID 22924724?
The InChIKey is YSNSGHQLHSEFHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15Cl2OSi/c1-3-5-7(8)11(9)10-6-4-2/h7H,3-6H2,1-2H3.
What are the key properties of CID 22924724?
CID 22924724 has a molecular weight of 214.19 g/mol, XLogP of 3.09, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 22924724 is sourced from PubChem (CID 22924724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).