C24H60O10Si6 — CID 101221735
2,2,4,4,8,8,10,10-octamethyl-6,6,12,12-tetrakis[(2-methylpropan-2-yl)oxy]-1,3,5,7,9,11-hexaoxa-2,4,6,8,10,12-hexasilacyclododecane (PubChem CID 101221735) has the molecular formula C24H60O10Si6 and a molecular weight of 677.25 g/mol. Its IUPAC name is 2,2,4,4,8,8,10,10-octamethyl-6,6,12,12-tetrakis[(2-methylpropan-2-yl)oxy]-1,3,5,7,9,11-hexaoxa-2,4,6,8,10,12-hexasilacyclododecane.
| Compound Name | 2,2,4,4,8,8,10,10-octamethyl-6,6,12,12-tetrakis[(2-methylpropan-2-yl)oxy]-1,3,5,7,9,11-hexaoxa-2,4,6,8,10,12-hexasilacyclododecane |
|---|---|
| PubChem CID | 101221735 |
| Molecular Formula | C24H60O10Si6 |
| Molecular Weight | 677.25 g/mol |
| Exact Mass | 676.28 |
| IUPAC Name | 2,2,4,4,8,8,10,10-octamethyl-6,6,12,12-tetrakis[(2-methylpropan-2-yl)oxy]-1,3,5,7,9,11-hexaoxa-2,4,6,8,10,12-hexasilacyclododecane |
| SMILES | CC(C)(C)O[Si]1(OC(C)(C)C)O[Si](C)(C)O[Si](C)(C)O[Si](OC(C)(C)C)(OC(C)(C)C)O[Si](C)(C)O[Si](C)(C)O1 |
| InChI | InChI=1S/C24H60O10Si6/c1-21(2,3)25-39(26-22(4,5)6)31-35(13,14)29-37(17,18)33-40(27-23(7,8)9,28-24(10,11)12)34-38(19,20)30-36(15,16)32-39/h1-20H3 |
| InChIKey | ZGLIVNBGZYAGPI-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 92.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.25 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|