C30H42O8Si7 — CID 3770210
[4,6-bis(dimethylsilyloxy)-8-hydroxy-2,4,6,8-tetraphenyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl]oxy-dimethylsilane (PubChem CID 3770210) has the molecular formula C30H42O8Si7 and a molecular weight of 727.26 g/mol. Its IUPAC name is [4,6-bis(dimethylsilyloxy)-8-hydroxy-2,4,6,8-tetraphenyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl]oxy-dimethylsilane.
| Compound Name | [4,6-bis(dimethylsilyloxy)-8-hydroxy-2,4,6,8-tetraphenyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl]oxy-dimethylsilane |
|---|---|
| PubChem CID | 3770210 |
| Molecular Formula | C30H42O8Si7 |
| Molecular Weight | 727.26 g/mol |
| Exact Mass | 726.13 |
| IUPAC Name | [4,6-bis(dimethylsilyloxy)-8-hydroxy-2,4,6,8-tetraphenyl-1,3,5,7,2,4,6,8-tetraoxatetrasilocan-2-yl]oxy-dimethylsilane |
| SMILES | C[SiH](C)O[Si]1(c2ccccc2)O[Si](O)(c2ccccc2)O[Si](O[SiH](C)C)(c2ccccc2)O[Si](O[SiH](C)C)(c2ccccc2)O1 |
| InChI | InChI=1S/C30H42O8Si7/c1-39(2)32-43(28-21-13-8-14-22-28)35-42(31,27-19-11-7-12-20-27)36-44(33-40(3)4,29-23-15-9-16-24-29)38-45(37-43,34-41(5)6)30-25-17-10-18-26-30/h7-26,31,39-41H,1-6H3 |
| InChIKey | ZHHZDSRQOVUOID-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.26 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|