C43H42O12Si7 — CID 123629525
(5,9-dihydroxy-1,3,5,7,9,11-hexakis-phenyl-2,4,6,8,10,12,13-heptaoxa-1,3,5,7,9,11-hexasilabicyclo[5.5.1]tridecan-3-yl)oxy-hydroxy-methoxy-phenylsilane (PubChem CID 123629525) has the molecular formula C43H42O12Si7 and a molecular weight of 947.40 g/mol. Its IUPAC name is (5,9-dihydroxy-1,3,5,7,9,11-hexakis-phenyl-2,4,6,8,10,12,13-heptaoxa-1,3,5,7,9,11-hexasilabicyclo[5.5.1]tridecan-3-yl)oxy-hydroxy-methoxy-phenylsilane.
| Compound Name | (5,9-dihydroxy-1,3,5,7,9,11-hexakis-phenyl-2,4,6,8,10,12,13-heptaoxa-1,3,5,7,9,11-hexasilabicyclo[5.5.1]tridecan-3-yl)oxy-hydroxy-methoxy-phenylsilane |
|---|---|
| PubChem CID | 123629525 |
| Molecular Formula | C43H42O12Si7 |
| Molecular Weight | 947.40 g/mol |
| Exact Mass | 946.11 |
| IUPAC Name | (5,9-dihydroxy-1,3,5,7,9,11-hexakis-phenyl-2,4,6,8,10,12,13-heptaoxa-1,3,5,7,9,11-hexasilabicyclo[5.5.1]tridecan-3-yl)oxy-hydroxy-methoxy-phenylsilane |
| SMILES | CO[Si](O)(O[Si]1(c2ccccc2)O[Si](O)(c2ccccc2)O[Si]2(c3ccccc3)O[Si](O)(c3ccccc3)O[SiH](c3ccccc3)O[Si](c3ccccc3)(O1)O2)c1ccccc1 |
| InChI | InChI=1S/C43H42O12Si7/c1-47-57(44,38-25-11-3-12-26-38)50-61(42-33-19-7-20-34-42)52-59(46,40-29-15-5-16-30-40)53-62(43-35-21-8-22-36-43)51-58(45,39-27-13-4-14-28-39)48-56(37-23-9-2-10-24-37)49-60(54-61,55-62)41-31-17-6-18-32-41/h2-36,44-46,56H,1H3 |
| InChIKey | WXBGFXGTDUIPCZ-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 143.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 947.40 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|