About dichloro(diphenyl)silane;tetrachlorosilane;tetramethyl silicate
dichloro(diphenyl)silane;tetrachlorosilane;tetramethyl silicate (PubChem CID 162192350) has the molecular formula C16H22Cl6O4Si3
and a molecular weight of 575.32 g/mol. Its IUPAC name is dichloro(diphenyl)silane;tetrachlorosilane;tetramethyl silicate.
Molecular Properties
| Compound Name | dichloro(diphenyl)silane;tetrachlorosilane;tetramethyl silicate |
| PubChem CID | 162192350 |
| Molecular Formula | C16H22Cl6O4Si3 |
| Molecular Weight | 575.32 g/mol |
| Exact Mass | 571.90 |
| IUPAC Name | dichloro(diphenyl)silane;tetrachlorosilane;tetramethyl silicate |
| SMILES | CO[Si](OC)(OC)OC.Cl[Si](Cl)(Cl)Cl.Cl[Si](Cl)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C12H10Cl2Si.C4H12O4Si.Cl4Si/c13-15(14,11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-5-9(6-2,7-3)8-4;1-5(2,3)4/h1-10H;1-4H3; |
| InChIKey | ZQLYJWUCZOUVSX-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 575.32 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|
Analyze dichloro(diphenyl)silane;tetrachlorosilane;tetramethyl silicate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloro(diphenyl)silane;tetrachlorosilane;tetramethyl silicate?
The IUPAC name of dichloro(diphenyl)silane;tetrachlorosilane;tetramethyl silicate (CID 162192350) is dichloro(diphenyl)silane;tetrachlorosilane;tetramethyl silicate.
What is the SMILES notation for dichloro(diphenyl)silane;tetrachlorosilane;tetramethyl silicate?
The canonical SMILES for dichloro(diphenyl)silane;tetrachlorosilane;tetramethyl silicate is CO[Si](OC)(OC)OC.Cl[Si](Cl)(Cl)Cl.Cl[Si](Cl)(c1ccccc1)c1ccccc1.
What is the InChIKey of dichloro(diphenyl)silane;tetrachlorosilane;tetramethyl silicate?
The InChIKey is ZQLYJWUCZOUVSX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10Cl2Si.C4H12O4Si.Cl4Si/c13-15(14,11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-5-9(6-2,7-3)8-4;1-5(2,3)4/h1-10H;1-4H3;.
What are the key properties of dichloro(diphenyl)silane;tetrachlorosilane;tetramethyl silicate?
dichloro(diphenyl)silane;tetrachlorosilane;tetramethyl silicate has a molecular weight of 575.32 g/mol, XLogP of 5.11, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for dichloro(diphenyl)silane;tetrachlorosilane;tetramethyl silicate is sourced from PubChem (CID 162192350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).