C30H26O4SSi2 — CID 143507736
4-hydroxy-2,2,4,6,6-pentakis-phenyl-1,3,5,2,4,6-trioxathiadisilinane (PubChem CID 143507736) has the molecular formula C30H26O4SSi2 and a molecular weight of 538.77 g/mol. Its IUPAC name is 4-hydroxy-2,2,4,6,6-pentakis-phenyl-1,3,5,2,4,6-trioxathiadisilinane.
| Compound Name | 4-hydroxy-2,2,4,6,6-pentakis-phenyl-1,3,5,2,4,6-trioxathiadisilinane |
|---|---|
| PubChem CID | 143507736 |
| Molecular Formula | C30H26O4SSi2 |
| Molecular Weight | 538.77 g/mol |
| Exact Mass | 538.11 |
| IUPAC Name | 4-hydroxy-2,2,4,6,6-pentakis-phenyl-1,3,5,2,4,6-trioxathiadisilinane |
| SMILES | O[Si]1(c2ccccc2)O[Si](c2ccccc2)(c2ccccc2)OS(c2ccccc2)(c2ccccc2)O1 |
| InChI | InChI=1S/C30H26O4SSi2/c31-37(30-24-14-5-15-25-30)33-35(26-16-6-1-7-17-26,27-18-8-2-9-19-27)32-36(34-37,28-20-10-3-11-21-28)29-22-12-4-13-23-29/h1-25,31H |
| InChIKey | AIYHSXNKRHOUCC-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.77 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|