C12H11NO2 — CID 121002695
11-hydroxy-10-azatricyclo[6.3.2.02,7]trideca-2,4,6,12-tetraen-9-one (PubChem CID 121002695) has the molecular formula C12H11NO2 and a molecular weight of 201.22 g/mol. Its IUPAC name is 11-hydroxy-10-azatricyclo[6.3.2.02,7]trideca-2,4,6,12-tetraen-9-one.
| Compound Name | 11-hydroxy-10-azatricyclo[6.3.2.02,7]trideca-2,4,6,12-tetraen-9-one |
|---|---|
| PubChem CID | 121002695 |
| Molecular Formula | C12H11NO2 |
| Molecular Weight | 201.22 g/mol |
| Exact Mass | 201.08 |
| IUPAC Name | 11-hydroxy-10-azatricyclo[6.3.2.02,7]trideca-2,4,6,12-tetraen-9-one |
| SMILES | O=C1NC(O)C2C=CC1c1ccccc12 |
| InChI | InChI=1S/C12H11NO2/c14-11-9-5-6-10(12(15)13-11)8-4-2-1-3-7(8)9/h1-6,9-11,14H,(H,13,15) |
| InChIKey | SKXXICFJIJPQMT-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.22 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|