C13H11NO — CID 98554052
(1R,10R)-11-azatricyclo[8.2.2.02,7]tetradeca-2,4,6,8,13-pentaen-12-one (PubChem CID 98554052) has the molecular formula C13H11NO and a molecular weight of 197.24 g/mol. Its IUPAC name is (1R,10R)-11-azatricyclo[8.2.2.02,7]tetradeca-2,4,6,8,13-pentaen-12-one.
| Compound Name | (1R,10R)-11-azatricyclo[8.2.2.02,7]tetradeca-2,4,6,8,13-pentaen-12-one |
|---|---|
| PubChem CID | 98554052 |
| Molecular Formula | C13H11NO |
| Molecular Weight | 197.24 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | (1R,10R)-11-azatricyclo[8.2.2.02,7]tetradeca-2,4,6,8,13-pentaen-12-one |
| SMILES | O=C1N[C@H]2C=Cc3ccccc3[C@H]1C=C2 |
| InChI | InChI=1S/C13H11NO/c15-13-12-8-7-10(14-13)6-5-9-3-1-2-4-11(9)12/h1-8,10,12H,(H,14,15)/t10-,12+/m0/s1 |
| InChIKey | ATAPBDNYDVXEHR-CMPLNLGQSA-N |
| XLogP | 1.85 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.24 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|