C12H10O2 — CID 98163918
(1S,8S)-tricyclo[6.2.2.02,7]dodeca-2,4,6-triene-9,10-dione (PubChem CID 98163918) has the molecular formula C12H10O2 and a molecular weight of 186.21 g/mol. Its IUPAC name is (1S,8S)-tricyclo[6.2.2.02,7]dodeca-2,4,6-triene-9,10-dione.
| Compound Name | (1S,8S)-tricyclo[6.2.2.02,7]dodeca-2,4,6-triene-9,10-dione |
|---|---|
| PubChem CID | 98163918 |
| Molecular Formula | C12H10O2 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.07 |
| IUPAC Name | (1S,8S)-tricyclo[6.2.2.02,7]dodeca-2,4,6-triene-9,10-dione |
| SMILES | O=C1C(=O)[C@H]2CC[C@H]1c1ccccc12 |
| InChI | InChI=1S/C12H10O2/c13-11-9-5-6-10(12(11)14)8-4-2-1-3-7(8)9/h1-4,9-10H,5-6H2/t9-,10-/m0/s1 |
| InChIKey | DSDLMLZIMHBXQJ-UWVGGRQHSA-N |
| XLogP | 1.80 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|