C13H9ClO — CID 91802156
[6-(2-chlorophenyl)cyclohexa-2,4-dien-1-ylidene]methanone (PubChem CID 91802156) has the molecular formula C13H9ClO and a molecular weight of 216.67 g/mol. Its IUPAC name is [6-(2-chlorophenyl)cyclohexa-2,4-dien-1-ylidene]methanone.
| Compound Name | [6-(2-chlorophenyl)cyclohexa-2,4-dien-1-ylidene]methanone |
|---|---|
| PubChem CID | 91802156 |
| Molecular Formula | C13H9ClO |
| Molecular Weight | 216.67 g/mol |
| Exact Mass | 216.03 |
| IUPAC Name | [6-(2-chlorophenyl)cyclohexa-2,4-dien-1-ylidene]methanone |
| SMILES | O=C=C1C=CC=CC1c1ccccc1Cl |
| InChI | InChI=1S/C13H9ClO/c14-13-8-4-3-7-12(13)11-6-2-1-5-10(11)9-15/h1-8,11H |
| InChIKey | OCBPFTANAUPDPT-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.67 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|