C12H9ClO — CID 169094136
6-(2-chlorophenyl)cyclohexa-2,4-dien-1-one (PubChem CID 169094136) has the molecular formula C12H9ClO and a molecular weight of 204.66 g/mol. Its IUPAC name is 6-(2-chlorophenyl)cyclohexa-2,4-dien-1-one.
| Compound Name | 6-(2-chlorophenyl)cyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 169094136 |
| Molecular Formula | C12H9ClO |
| Molecular Weight | 204.66 g/mol |
| Exact Mass | 204.03 |
| IUPAC Name | 6-(2-chlorophenyl)cyclohexa-2,4-dien-1-one |
| SMILES | O=C1C=CC=CC1c1ccccc1Cl |
| InChI | InChI=1S/C12H9ClO/c13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)14/h1-8,10H |
| InChIKey | OGCBWWLODLPGGR-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.66 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |