C14H9ClCrO5 — CID 11013373
carbon monoxide;2-(2-chlorophenyl)-2,3-dihydropyran-4-one;chromium (PubChem CID 11013373) has the molecular formula C14H9ClCrO5 and a molecular weight of 344.67 g/mol. Its IUPAC name is carbon monoxide;2-(2-chlorophenyl)-2,3-dihydropyran-4-one;chromium.
| Compound Name | carbon monoxide;2-(2-chlorophenyl)-2,3-dihydropyran-4-one;chromium |
|---|---|
| PubChem CID | 11013373 |
| Molecular Formula | C14H9ClCrO5 |
| Molecular Weight | 344.67 g/mol |
| Exact Mass | 343.95 |
| IUPAC Name | carbon monoxide;2-(2-chlorophenyl)-2,3-dihydropyran-4-one;chromium |
| SMILES | O=C1C=COC(c2ccccc2Cl)C1.[C-]#[O+].[C-]#[O+].[C-]#[O+].[Cr] |
| InChI | InChI=1S/C11H9ClO2.3CO.Cr/c12-10-4-2-1-3-9(10)11-7-8(13)5-6-14-11;3*1-2;/h1-6,11H,7H2;;;; |
| InChIKey | CEKHIYYCPOASKH-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 86.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.67 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|