C10H9ClO — CID 139822422
(2R)-2-(2-chlorophenyl)-2,3-dihydrofuran (PubChem CID 139822422) has the molecular formula C10H9ClO and a molecular weight of 180.63 g/mol. Its IUPAC name is (2R)-2-(2-chlorophenyl)-2,3-dihydrofuran.
| Compound Name | (2R)-2-(2-chlorophenyl)-2,3-dihydrofuran |
|---|---|
| PubChem CID | 139822422 |
| Molecular Formula | C10H9ClO |
| Molecular Weight | 180.63 g/mol |
| Exact Mass | 180.03 |
| IUPAC Name | (2R)-2-(2-chlorophenyl)-2,3-dihydrofuran |
| SMILES | Clc1ccccc1[C@H]1CC=CO1 |
| InChI | InChI=1S/C10H9ClO/c11-9-5-2-1-4-8(9)10-6-3-7-12-10/h1-5,7,10H,6H2/t10-/m1/s1 |
| InChIKey | CHLBPLSHOOXFTG-SNVBAGLBSA-N |
| XLogP | 3.32 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.63 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |