C11H11ClO2 — CID 12562262
2-(2-chlorophenyl)-4,7-dihydro-1,3-dioxepine (PubChem CID 12562262) has the molecular formula C11H11ClO2 and a molecular weight of 210.66 g/mol. Its IUPAC name is 2-(2-chlorophenyl)-4,7-dihydro-1,3-dioxepine.
| Compound Name | 2-(2-chlorophenyl)-4,7-dihydro-1,3-dioxepine |
|---|---|
| PubChem CID | 12562262 |
| Molecular Formula | C11H11ClO2 |
| Molecular Weight | 210.66 g/mol |
| Exact Mass | 210.04 |
| IUPAC Name | 2-(2-chlorophenyl)-4,7-dihydro-1,3-dioxepine |
| SMILES | Clc1ccccc1C1OCC=CCO1 |
| InChI | InChI=1S/C11H11ClO2/c12-10-6-2-1-5-9(10)11-13-7-3-4-8-14-11/h1-6,11H,7-8H2 |
| InChIKey | YHUIMNUNWQZLMD-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.66 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|