C10H10Cl2O2 — CID 36690006
(2R,4R)-4-(chloromethyl)-2-(2-chlorophenyl)-1,3-dioxolane (PubChem CID 36690006) has the molecular formula C10H10Cl2O2 and a molecular weight of 233.09 g/mol. Its IUPAC name is (2R,4R)-4-(chloromethyl)-2-(2-chlorophenyl)-1,3-dioxolane.
| Compound Name | (2R,4R)-4-(chloromethyl)-2-(2-chlorophenyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 36690006 |
| Molecular Formula | C10H10Cl2O2 |
| Molecular Weight | 233.09 g/mol |
| Exact Mass | 232.01 |
| IUPAC Name | (2R,4R)-4-(chloromethyl)-2-(2-chlorophenyl)-1,3-dioxolane |
| SMILES | ClC[C@H]1CO[C@@H](c2ccccc2Cl)O1 |
| InChI | InChI=1S/C10H10Cl2O2/c11-5-7-6-13-10(14-7)8-3-1-2-4-9(8)12/h1-4,7,10H,5-6H2/t7-,10+/m0/s1 |
| InChIKey | GIMPQTBULMJYJR-OIBJUYFYSA-N |
| XLogP | 2.99 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.09 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|