C11H14O3 — CID 94253898
[(2R,4S)-2-(2-methylphenyl)-1,3-dioxolan-4-yl]methanol (PubChem CID 94253898) has the molecular formula C11H14O3 and a molecular weight of 194.23 g/mol. Its IUPAC name is [(2R,4S)-2-(2-methylphenyl)-1,3-dioxolan-4-yl]methanol.
| Compound Name | [(2R,4S)-2-(2-methylphenyl)-1,3-dioxolan-4-yl]methanol |
|---|---|
| PubChem CID | 94253898 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | [(2R,4S)-2-(2-methylphenyl)-1,3-dioxolan-4-yl]methanol |
| SMILES | Cc1ccccc1[C@@H]1OC[C@H](CO)O1 |
| InChI | InChI=1S/C11H14O3/c1-8-4-2-3-5-10(8)11-13-7-9(6-12)14-11/h2-5,9,11-12H,6-7H2,1H3/t9-,11+/m0/s1 |
| InChIKey | SZESZZKBJJPMKG-GXSJLCMTSA-N |
| XLogP | 1.40 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |