C10H12O4 — CID 82112171
4-[4-(hydroxymethyl)-1,3-dioxolan-2-yl]phenol (PubChem CID 82112171) has the molecular formula C10H12O4 and a molecular weight of 196.20 g/mol. Its IUPAC name is 4-[4-(hydroxymethyl)-1,3-dioxolan-2-yl]phenol.
| Compound Name | 4-[4-(hydroxymethyl)-1,3-dioxolan-2-yl]phenol |
|---|---|
| PubChem CID | 82112171 |
| Molecular Formula | C10H12O4 |
| Molecular Weight | 196.20 g/mol |
| Exact Mass | 196.07 |
| IUPAC Name | 4-[4-(hydroxymethyl)-1,3-dioxolan-2-yl]phenol |
| SMILES | OCC1COC(c2ccc(O)cc2)O1 |
| InChI | InChI=1S/C10H12O4/c11-5-9-6-13-10(14-9)7-1-3-8(12)4-2-7/h1-4,9-12H,5-6H2 |
| InChIKey | PKSDGRVYPISOPY-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.20 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |