About [(2S,4S)-2-(2-methylphenyl)-1,3-dioxolan-4-yl]methanol
[(2S,4S)-2-(2-methylphenyl)-1,3-dioxolan-4-yl]methanol (PubChem CID 94253899) has the molecular formula C11H14O3
and a molecular weight of 194.23 g/mol. Its IUPAC name is [(2S,4S)-2-(2-methylphenyl)-1,3-dioxolan-4-yl]methanol.
Molecular Properties
| Compound Name | [(2S,4S)-2-(2-methylphenyl)-1,3-dioxolan-4-yl]methanol |
| PubChem CID | 94253899 |
| Molecular Formula | C11H14O3 |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.09 |
| IUPAC Name | [(2S,4S)-2-(2-methylphenyl)-1,3-dioxolan-4-yl]methanol |
| SMILES | Cc1ccccc1[C@H]1OC[C@H](CO)O1 |
| InChI | InChI=1S/C11H14O3/c1-8-4-2-3-5-10(8)11-13-7-9(6-12)14-11/h2-5,9,11-12H,6-7H2,1H3/t9-,11-/m0/s1 |
| InChIKey | SZESZZKBJJPMKG-ONGXEEELSA-N |
| XLogP | 1.40 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(2S,4S)-2-(2-methylphenyl)-1,3-dioxolan-4-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2S,4S)-2-(2-methylphenyl)-1,3-dioxolan-4-yl]methanol?
The IUPAC name of [(2S,4S)-2-(2-methylphenyl)-1,3-dioxolan-4-yl]methanol (CID 94253899) is [(2S,4S)-2-(2-methylphenyl)-1,3-dioxolan-4-yl]methanol.
What is the SMILES notation for [(2S,4S)-2-(2-methylphenyl)-1,3-dioxolan-4-yl]methanol?
The canonical SMILES for [(2S,4S)-2-(2-methylphenyl)-1,3-dioxolan-4-yl]methanol is Cc1ccccc1[C@H]1OC[C@H](CO)O1.
What is the InChIKey of [(2S,4S)-2-(2-methylphenyl)-1,3-dioxolan-4-yl]methanol?
The InChIKey is SZESZZKBJJPMKG-ONGXEEELSA-N. The full InChI is InChI=1S/C11H14O3/c1-8-4-2-3-5-10(8)11-13-7-9(6-12)14-11/h2-5,9,11-12H,6-7H2,1H3/t9-,11-/m0/s1.
What are the key properties of [(2S,4S)-2-(2-methylphenyl)-1,3-dioxolan-4-yl]methanol?
[(2S,4S)-2-(2-methylphenyl)-1,3-dioxolan-4-yl]methanol has a molecular weight of 194.23 g/mol, XLogP of 1.40, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2S,4S)-2-(2-methylphenyl)-1,3-dioxolan-4-yl]methanol is sourced from PubChem (CID 94253899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).