About (2-methylphenyl)methanediol;propane-1,2,3-triol
(2-methylphenyl)methanediol;propane-1,2,3-triol (PubChem CID 6451245) has the molecular formula C11H18O5
and a molecular weight of 230.26 g/mol. Its IUPAC name is (2-methylphenyl)methanediol;propane-1,2,3-triol.
Molecular Properties
| Compound Name | (2-methylphenyl)methanediol;propane-1,2,3-triol |
| PubChem CID | 6451245 |
| Molecular Formula | C11H18O5 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | (2-methylphenyl)methanediol;propane-1,2,3-triol |
| SMILES | Cc1ccccc1C(O)O.OCC(O)CO |
| InChI | InChI=1S/C8H10O2.C3H8O3/c1-6-4-2-3-5-7(6)8(9)10;4-1-3(6)2-5/h2-5,8-10H,1H3;3-6H,1-2H2 |
| InChIKey | WNARAGIYGCZQQM-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (2-methylphenyl)methanediol;propane-1,2,3-triol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methylphenyl)methanediol;propane-1,2,3-triol?
The IUPAC name of (2-methylphenyl)methanediol;propane-1,2,3-triol (CID 6451245) is (2-methylphenyl)methanediol;propane-1,2,3-triol.
What is the SMILES notation for (2-methylphenyl)methanediol;propane-1,2,3-triol?
The canonical SMILES for (2-methylphenyl)methanediol;propane-1,2,3-triol is Cc1ccccc1C(O)O.OCC(O)CO.
What is the InChIKey of (2-methylphenyl)methanediol;propane-1,2,3-triol?
The InChIKey is WNARAGIYGCZQQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O2.C3H8O3/c1-6-4-2-3-5-7(6)8(9)10;4-1-3(6)2-5/h2-5,8-10H,1H3;3-6H,1-2H2.
What are the key properties of (2-methylphenyl)methanediol;propane-1,2,3-triol?
(2-methylphenyl)methanediol;propane-1,2,3-triol has a molecular weight of 230.26 g/mol, XLogP of -0.69, 3 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methylphenyl)methanediol;propane-1,2,3-triol is sourced from PubChem (CID 6451245), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).