C11H18O5 — CID 6451245
(2-methylphenyl)methanediol;propane-1,2,3-triol (PubChem CID 6451245) has the molecular formula C11H18O5 and a molecular weight of 230.26 g/mol. Its IUPAC name is (2-methylphenyl)methanediol;propane-1,2,3-triol.
| Compound Name | (2-methylphenyl)methanediol;propane-1,2,3-triol |
|---|---|
| PubChem CID | 6451245 |
| Molecular Formula | C11H18O5 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | (2-methylphenyl)methanediol;propane-1,2,3-triol |
| SMILES | Cc1ccccc1C(O)O.OCC(O)CO |
| InChI | InChI=1S/C8H10O2.C3H8O3/c1-6-4-2-3-5-7(6)8(9)10;4-1-3(6)2-5/h2-5,8-10H,1H3;3-6H,1-2H2 |
| InChIKey | WNARAGIYGCZQQM-UHFFFAOYSA-N |
| XLogP | -0.69 |
| TPSA | 101.15 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | -0.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|