C12H15ClO2 — CID 79022148
4-(chloromethyl)-2-(4-ethylphenyl)-1,3-dioxolane (PubChem CID 79022148) has the molecular formula C12H15ClO2 and a molecular weight of 226.70 g/mol. Its IUPAC name is 4-(chloromethyl)-2-(4-ethylphenyl)-1,3-dioxolane.
| Compound Name | 4-(chloromethyl)-2-(4-ethylphenyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 79022148 |
| Molecular Formula | C12H15ClO2 |
| Molecular Weight | 226.70 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 4-(chloromethyl)-2-(4-ethylphenyl)-1,3-dioxolane |
| SMILES | CCc1ccc(C2OCC(CCl)O2)cc1 |
| InChI | InChI=1S/C12H15ClO2/c1-2-9-3-5-10(6-4-9)12-14-8-11(7-13)15-12/h3-6,11-12H,2,7-8H2,1H3 |
| InChIKey | NTIGMQPDDSJBNK-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.70 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|