C11H13ClO2 — CID 79022072
4-(chloromethyl)-2-(3-methylphenyl)-1,3-dioxolane (PubChem CID 79022072) has the molecular formula C11H13ClO2 and a molecular weight of 212.68 g/mol. Its IUPAC name is 4-(chloromethyl)-2-(3-methylphenyl)-1,3-dioxolane.
| Compound Name | 4-(chloromethyl)-2-(3-methylphenyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 79022072 |
| Molecular Formula | C11H13ClO2 |
| Molecular Weight | 212.68 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | 4-(chloromethyl)-2-(3-methylphenyl)-1,3-dioxolane |
| SMILES | Cc1cccc(C2OCC(CCl)O2)c1 |
| InChI | InChI=1S/C11H13ClO2/c1-8-3-2-4-9(5-8)11-13-7-10(6-12)14-11/h2-5,10-11H,6-7H2,1H3 |
| InChIKey | PPZVUPUVOMBBIO-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.68 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|