C10H10Cl2O3 — CID 163756517
[2-(2,4-dichlorophenyl)-1,3-dioxolan-4-yl]methanol (PubChem CID 163756517) has the molecular formula C10H10Cl2O3 and a molecular weight of 249.09 g/mol. Its IUPAC name is [2-(2,4-dichlorophenyl)-1,3-dioxolan-4-yl]methanol.
| Compound Name | [2-(2,4-dichlorophenyl)-1,3-dioxolan-4-yl]methanol |
|---|---|
| PubChem CID | 163756517 |
| Molecular Formula | C10H10Cl2O3 |
| Molecular Weight | 249.09 g/mol |
| Exact Mass | 248.00 |
| IUPAC Name | [2-(2,4-dichlorophenyl)-1,3-dioxolan-4-yl]methanol |
| SMILES | OCC1COC(c2ccc(Cl)cc2Cl)O1 |
| InChI | InChI=1S/C10H10Cl2O3/c11-6-1-2-8(9(12)3-6)10-14-5-7(4-13)15-10/h1-3,7,10,13H,4-5H2 |
| InChIKey | LUNCRHBTTIJTHM-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.09 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |