C32H35Cl2N5O5 — CID 129168240
4-[4-[4-[4-[[(2R,4R)-2-(2,4-dichlorophenyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-2-(3-hydroxybutan-2-yl)-1,2,4-triazol-3-one (PubChem CID 129168240) has the molecular formula C32H35Cl2N5O5 and a molecular weight of 640.57 g/mol. Its IUPAC name is 4-[4-[4-[4-[[(2R,4R)-2-(2,4-dichlorophenyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-2-(3-hydroxybutan-2-yl)-1,2,4-triazol-3-one.
| Compound Name | 4-[4-[4-[4-[[(2R,4R)-2-(2,4-dichlorophenyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-2-(3-hydroxybutan-2-yl)-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 129168240 |
| Molecular Formula | C32H35Cl2N5O5 |
| Molecular Weight | 640.57 g/mol |
| Exact Mass | 639.20 |
| IUPAC Name | 4-[4-[4-[4-[[(2R,4R)-2-(2,4-dichlorophenyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-2-(3-hydroxybutan-2-yl)-1,2,4-triazol-3-one |
| SMILES | CC(O)C(C)n1ncn(-c2ccc(N3CCN(c4ccc(OC[C@@H]5CO[C@@H](c6ccc(Cl)cc6Cl)O5)cc4)CC3)cc2)c1=O |
| InChI | InChI=1S/C32H35Cl2N5O5/c1-21(22(2)40)39-32(41)38(20-35-39)26-6-4-24(5-7-26)36-13-15-37(16-14-36)25-8-10-27(11-9-25)42-18-28-19-43-31(44-28)29-12-3-23(33)17-30(29)34/h3-12,17,20-22,28,31,40H,13-16,18-19H2,1-2H3/t21?,22?,28-,31-/m1/s1 |
| InChIKey | MLXSJAYIVVEHHN-GHRFSASESA-N |
| XLogP | 5.10 |
| TPSA | 94.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 640.57 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|