C33H34Cl2N6O4 — CID 129168298
2-[4-[4-(1-butan-2-yl-5-oxo-1,2,4-triazol-4-yl)phenyl]piperazin-1-yl]-5-[[(2R,4R)-2-(2,4-dichlorophenyl)-1,3-dioxolan-4-yl]methoxy]benzonitrile (PubChem CID 129168298) has the molecular formula C33H34Cl2N6O4 and a molecular weight of 649.58 g/mol. Its IUPAC name is 2-[4-[4-(1-butan-2-yl-5-oxo-1,2,4-triazol-4-yl)phenyl]piperazin-1-yl]-5-[[(2R,4R)-2-(2,4-dichlorophenyl)-1,3-dioxolan-4-yl]methoxy]benzonitrile.
| Compound Name | 2-[4-[4-(1-butan-2-yl-5-oxo-1,2,4-triazol-4-yl)phenyl]piperazin-1-yl]-5-[[(2R,4R)-2-(2,4-dichlorophenyl)-1,3-dioxolan-4-yl]methoxy]benzonitrile |
|---|---|
| PubChem CID | 129168298 |
| Molecular Formula | C33H34Cl2N6O4 |
| Molecular Weight | 649.58 g/mol |
| Exact Mass | 648.20 |
| IUPAC Name | 2-[4-[4-(1-butan-2-yl-5-oxo-1,2,4-triazol-4-yl)phenyl]piperazin-1-yl]-5-[[(2R,4R)-2-(2,4-dichlorophenyl)-1,3-dioxolan-4-yl]methoxy]benzonitrile |
| SMILES | CCC(C)n1ncn(-c2ccc(N3CCN(c4ccc(OC[C@@H]5CO[C@@H](c6ccc(Cl)cc6Cl)O5)cc4C#N)CC3)cc2)c1=O |
| InChI | InChI=1S/C33H34Cl2N6O4/c1-3-22(2)41-33(42)40(21-37-41)26-7-5-25(6-8-26)38-12-14-39(15-13-38)31-11-9-27(16-23(31)18-36)43-19-28-20-44-32(45-28)29-10-4-24(34)17-30(29)35/h4-11,16-17,21-22,28,32H,3,12-15,19-20H2,1-2H3/t22?,28-,32-/m1/s1 |
| InChIKey | GVMRQJVNUCSVDL-OHIXXBALSA-N |
| XLogP | 6.00 |
| TPSA | 97.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 649.58 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|