C30H35N7O4 — CID 129168249
2-butan-2-yl-4-[4-[4-[4-[[(2R,4R)-2-pyrimidin-2-yl-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-1,2,4-triazol-3-one (PubChem CID 129168249) has the molecular formula C30H35N7O4 and a molecular weight of 557.66 g/mol. Its IUPAC name is 2-butan-2-yl-4-[4-[4-[4-[[(2R,4R)-2-pyrimidin-2-yl-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-1,2,4-triazol-3-one.
| Compound Name | 2-butan-2-yl-4-[4-[4-[4-[[(2R,4R)-2-pyrimidin-2-yl-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 129168249 |
| Molecular Formula | C30H35N7O4 |
| Molecular Weight | 557.66 g/mol |
| Exact Mass | 557.28 |
| IUPAC Name | 2-butan-2-yl-4-[4-[4-[4-[[(2R,4R)-2-pyrimidin-2-yl-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-1,2,4-triazol-3-one |
| SMILES | CCC(C)n1ncn(-c2ccc(N3CCN(c4ccc(OC[C@@H]5CO[C@@H](c6ncccn6)O5)cc4)CC3)cc2)c1=O |
| InChI | InChI=1S/C30H35N7O4/c1-3-22(2)37-30(38)36(21-33-37)25-7-5-23(6-8-25)34-15-17-35(18-16-34)24-9-11-26(12-10-24)39-19-27-20-40-29(41-27)28-31-13-4-14-32-28/h4-14,21-22,27,29H,3,15-20H2,1-2H3/t22?,27-,29-/m1/s1 |
| InChIKey | GAXLROBOKKGCBQ-KRNOIOAMSA-N |
| XLogP | 3.61 |
| TPSA | 99.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.66 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|